C16H22N4O4 — CID 171687066
formic acid;3-[4-[[methyl(1-pyridin-2-ylethyl)amino]methyl]pyrazol-1-yl]propanoic acid (PubChem CID 171687066) has the molecular formula C16H22N4O4 and a molecular weight of 334.38 g/mol. Its IUPAC name is formic acid;3-[4-[[methyl(1-pyridin-2-ylethyl)amino]methyl]pyrazol-1-yl]propanoic acid.
| Compound Name | formic acid;3-[4-[[methyl(1-pyridin-2-ylethyl)amino]methyl]pyrazol-1-yl]propanoic acid |
|---|---|
| PubChem CID | 171687066 |
| Molecular Formula | C16H22N4O4 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | formic acid;3-[4-[[methyl(1-pyridin-2-ylethyl)amino]methyl]pyrazol-1-yl]propanoic acid |
| SMILES | CC(c1ccccn1)N(C)Cc1cnn(CCC(=O)O)c1.O=CO |
| InChI | InChI=1S/C15H20N4O2.CH2O2/c1-12(14-5-3-4-7-16-14)18(2)10-13-9-17-19(11-13)8-6-15(20)21;2-1-3/h3-5,7,9,11-12H,6,8,10H2,1-2H3,(H,20,21);1H,(H,2,3) |
| InChIKey | WXSHMPJLTMQWLI-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 108.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|