C24H44N4O4 — CID 171687217
tert-butyl 2,8-diazaspiro[3.5]nonane-2-carboxylate (PubChem CID 171687217) has the molecular formula C24H44N4O4 and a molecular weight of 452.64 g/mol. Its IUPAC name is tert-butyl 2,8-diazaspiro[3.5]nonane-2-carboxylate.
| Compound Name | tert-butyl 2,8-diazaspiro[3.5]nonane-2-carboxylate |
|---|---|
| PubChem CID | 171687217 |
| Molecular Formula | C24H44N4O4 |
| Molecular Weight | 452.64 g/mol |
| Exact Mass | 452.34 |
| IUPAC Name | tert-butyl 2,8-diazaspiro[3.5]nonane-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC2(CCCNC2)C1.CC(C)(C)OC(=O)N1CC2(CCCNC2)C1 |
| InChI | InChI=1S/2C12H22N2O2/c2*1-11(2,3)16-10(15)14-8-12(9-14)5-4-6-13-7-12/h2*13H,4-9H2,1-3H3 |
| InChIKey | KJGOXPXWGXHILR-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.64 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |