C16H25ClN2OS — CID 171688420
1-[(5aS,9aR)-1,2,3,4,5,5a,6,8,9,9a-decahydropyrido[4,3-b]azepin-7-yl]-3-thiophen-2-ylpropan-1-one;hydrochloride (PubChem CID 171688420) has the molecular formula C16H25ClN2OS and a molecular weight of 328.91 g/mol. Its IUPAC name is 1-[(5aS,9aR)-1,2,3,4,5,5a,6,8,9,9a-decahydropyrido[4,3-b]azepin-7-yl]-3-thiophen-2-ylpropan-1-one;hydrochloride.
| Compound Name | 1-[(5aS,9aR)-1,2,3,4,5,5a,6,8,9,9a-decahydropyrido[4,3-b]azepin-7-yl]-3-thiophen-2-ylpropan-1-one;hydrochloride |
|---|---|
| PubChem CID | 171688420 |
| Molecular Formula | C16H25ClN2OS |
| Molecular Weight | 328.91 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | 1-[(5aS,9aR)-1,2,3,4,5,5a,6,8,9,9a-decahydropyrido[4,3-b]azepin-7-yl]-3-thiophen-2-ylpropan-1-one;hydrochloride |
| SMILES | Cl.O=C(CCc1cccs1)N1CC[C@H]2NCCCC[C@H]2C1 |
| InChI | InChI=1S/C16H24N2OS.ClH/c19-16(7-6-14-5-3-11-20-14)18-10-8-15-13(12-18)4-1-2-9-17-15;/h3,5,11,13,15,17H,1-2,4,6-10,12H2;1H/t13-,15+;/m0./s1 |
| InChIKey | VLPLAVBCTXPXNT-NQQJLSKUSA-N |
| XLogP | 3.09 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.91 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |