C16H20N8O — CID 171690523
1-methyl-N-[1-(9-methylpurin-6-yl)piperidin-3-yl]pyrazole-4-carboxamide (PubChem CID 171690523) has the molecular formula C16H20N8O and a molecular weight of 340.39 g/mol. Its IUPAC name is 1-methyl-N-[1-(9-methylpurin-6-yl)piperidin-3-yl]pyrazole-4-carboxamide.
| Compound Name | 1-methyl-N-[1-(9-methylpurin-6-yl)piperidin-3-yl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 171690523 |
| Molecular Formula | C16H20N8O |
| Molecular Weight | 340.39 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | 1-methyl-N-[1-(9-methylpurin-6-yl)piperidin-3-yl]pyrazole-4-carboxamide |
| SMILES | Cn1cc(C(=O)NC2CCCN(c3ncnc4c3ncn4C)C2)cn1 |
| InChI | InChI=1S/C16H20N8O/c1-22-10-19-13-14(22)17-9-18-15(13)24-5-3-4-12(8-24)21-16(25)11-6-20-23(2)7-11/h6-7,9-10,12H,3-5,8H2,1-2H3,(H,21,25) |
| InChIKey | UYICKILTRMQYSN-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 93.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.39 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |