C18H25F3N4O3S — CID 171695067
4-[[7-(ethoxymethyl)-1-ethyl-6,7-dihydro-4H-pyrazolo[4,5-c]pyridin-5-yl]methyl]-2-methyl-1,3-thiazole;2,2,2-trifluoroacetic acid (PubChem CID 171695067) has the molecular formula C18H25F3N4O3S and a molecular weight of 434.48 g/mol. Its IUPAC name is 4-[[7-(ethoxymethyl)-1-ethyl-6,7-dihydro-4H-pyrazolo[4,5-c]pyridin-5-yl]methyl]-2-methyl-1,3-thiazole;2,2,2-trifluoroacetic acid.
| Compound Name | 4-[[7-(ethoxymethyl)-1-ethyl-6,7-dihydro-4H-pyrazolo[4,5-c]pyridin-5-yl]methyl]-2-methyl-1,3-thiazole;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 171695067 |
| Molecular Formula | C18H25F3N4O3S |
| Molecular Weight | 434.48 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | 4-[[7-(ethoxymethyl)-1-ethyl-6,7-dihydro-4H-pyrazolo[4,5-c]pyridin-5-yl]methyl]-2-methyl-1,3-thiazole;2,2,2-trifluoroacetic acid |
| SMILES | CCOCC1CN(Cc2csc(C)n2)Cc2cnn(CC)c21.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H24N4OS.C2HF3O2/c1-4-20-16-13(6-17-20)7-19(8-14(16)10-21-5-2)9-15-11-22-12(3)18-15;3-2(4,5)1(6)7/h6,11,14H,4-5,7-10H2,1-3H3;(H,6,7) |
| InChIKey | YRHTZWHYQMCIFE-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.48 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |