C30H40N4O6 — CID 17169729
1-N',4-N'-bis[2-(3,4-dimethylphenoxy)propanoyl]cyclohexane-1,4-dicarbohydrazide (PubChem CID 17169729) has the molecular formula C30H40N4O6 and a molecular weight of 552.67 g/mol. Its IUPAC name is 1-N',4-N'-bis[2-(3,4-dimethylphenoxy)propanoyl]cyclohexane-1,4-dicarbohydrazide.
| Compound Name | 1-N',4-N'-bis[2-(3,4-dimethylphenoxy)propanoyl]cyclohexane-1,4-dicarbohydrazide |
|---|---|
| PubChem CID | 17169729 |
| Molecular Formula | C30H40N4O6 |
| Molecular Weight | 552.67 g/mol |
| Exact Mass | 552.29 |
| IUPAC Name | 1-N',4-N'-bis[2-(3,4-dimethylphenoxy)propanoyl]cyclohexane-1,4-dicarbohydrazide |
| SMILES | Cc1ccc(OC(C)C(=O)NNC(=O)C2CCC(C(=O)NNC(=O)C(C)Oc3ccc(C)c(C)c3)CC2)cc1C |
| InChI | InChI=1S/C30H40N4O6/c1-17-7-13-25(15-19(17)3)39-21(5)27(35)31-33-29(37)23-9-11-24(12-10-23)30(38)34-32-28(36)22(6)40-26-14-8-18(2)20(4)16-26/h7-8,13-16,21-24H,9-12H2,1-6H3,(H,31,35)(H,32,36)(H,33,37)(H,34,38) |
| InChIKey | YOLNCFHGDAOWKA-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 134.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.67 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|