C17H19N3O5S — CID 171697813
N-[(2S)-1-amino-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]-3-(methanesulfonamido)benzamide (PubChem CID 171697813) has the molecular formula C17H19N3O5S and a molecular weight of 377.42 g/mol. Its IUPAC name is N-[(2S)-1-amino-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]-3-(methanesulfonamido)benzamide.
| Compound Name | N-[(2S)-1-amino-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]-3-(methanesulfonamido)benzamide |
|---|---|
| PubChem CID | 171697813 |
| Molecular Formula | C17H19N3O5S |
| Molecular Weight | 377.42 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | N-[(2S)-1-amino-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]-3-(methanesulfonamido)benzamide |
| SMILES | CS(=O)(=O)Nc1cccc(C(=O)N[C@@H](Cc2ccc(O)cc2)C(N)=O)c1 |
| InChI | InChI=1S/C17H19N3O5S/c1-26(24,25)20-13-4-2-3-12(10-13)17(23)19-15(16(18)22)9-11-5-7-14(21)8-6-11/h2-8,10,15,20-21H,9H2,1H3,(H2,18,22)(H,19,23)/t15-/m0/s1 |
| InChIKey | LBLZMFOLKUQTCP-HNNXBMFYSA-N |
| XLogP | 0.59 |
| TPSA | 138.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.42 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |