C11H11ClF2N2O — CID 171701399
N-(2-chlorophenyl)-2-(3,3-difluoroazetidin-1-yl)acetamide (PubChem CID 171701399) has the molecular formula C11H11ClF2N2O and a molecular weight of 260.67 g/mol. Its IUPAC name is N-(2-chlorophenyl)-2-(3,3-difluoroazetidin-1-yl)acetamide.
| Compound Name | N-(2-chlorophenyl)-2-(3,3-difluoroazetidin-1-yl)acetamide |
|---|---|
| PubChem CID | 171701399 |
| Molecular Formula | C11H11ClF2N2O |
| Molecular Weight | 260.67 g/mol |
| Exact Mass | 260.05 |
| IUPAC Name | N-(2-chlorophenyl)-2-(3,3-difluoroazetidin-1-yl)acetamide |
| SMILES | O=C(CN1CC(F)(F)C1)Nc1ccccc1Cl |
| InChI | InChI=1S/C11H11ClF2N2O/c12-8-3-1-2-4-9(8)15-10(17)5-16-6-11(13,14)7-16/h1-4H,5-7H2,(H,15,17) |
| InChIKey | IFGGRBVTZZXVEY-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.67 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |