C19H21F3N4O — CID 171702215
2-cyclopropyl-4-[3-[[2-(trifluoromethyl)-4-pyridinyl]oxymethyl]piperidin-1-yl]pyrimidine (PubChem CID 171702215) has the molecular formula C19H21F3N4O and a molecular weight of 378.40 g/mol. Its IUPAC name is 2-cyclopropyl-4-[3-[[2-(trifluoromethyl)-4-pyridinyl]oxymethyl]piperidin-1-yl]pyrimidine.
| Compound Name | 2-cyclopropyl-4-[3-[[2-(trifluoromethyl)-4-pyridinyl]oxymethyl]piperidin-1-yl]pyrimidine |
|---|---|
| PubChem CID | 171702215 |
| Molecular Formula | C19H21F3N4O |
| Molecular Weight | 378.40 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | 2-cyclopropyl-4-[3-[[2-(trifluoromethyl)-4-pyridinyl]oxymethyl]piperidin-1-yl]pyrimidine |
| SMILES | FC(F)(F)c1cc(OCC2CCCN(c3ccnc(C4CC4)n3)C2)ccn1 |
| InChI | InChI=1S/C19H21F3N4O/c20-19(21,22)16-10-15(5-7-23-16)27-12-13-2-1-9-26(11-13)17-6-8-24-18(25-17)14-3-4-14/h5-8,10,13-14H,1-4,9,11-12H2 |
| InChIKey | IDQGRMVQDQLFAV-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 51.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.40 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |