C25H24BrNO4 — CID 17170263
2-(2-bromo-4-phenylphenoxy)-N-[2-(oxolan-2-ylmethoxy)phenyl]acetamide (PubChem CID 17170263) has the molecular formula C25H24BrNO4 and a molecular weight of 482.37 g/mol. Its IUPAC name is 2-(2-bromo-4-phenylphenoxy)-N-[2-(oxolan-2-ylmethoxy)phenyl]acetamide.
| Compound Name | 2-(2-bromo-4-phenylphenoxy)-N-[2-(oxolan-2-ylmethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 17170263 |
| Molecular Formula | C25H24BrNO4 |
| Molecular Weight | 482.37 g/mol |
| Exact Mass | 481.09 |
| IUPAC Name | 2-(2-bromo-4-phenylphenoxy)-N-[2-(oxolan-2-ylmethoxy)phenyl]acetamide |
| SMILES | O=C(COc1ccc(-c2ccccc2)cc1Br)Nc1ccccc1OCC1CCCO1 |
| InChI | InChI=1S/C25H24BrNO4/c26-21-15-19(18-7-2-1-3-8-18)12-13-23(21)31-17-25(28)27-22-10-4-5-11-24(22)30-16-20-9-6-14-29-20/h1-5,7-8,10-13,15,20H,6,9,14,16-17H2,(H,27,28) |
| InChIKey | AWZJLCGQCJYHBR-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.37 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |