C23H22ClF3N6O3 — CID 171706350
3-N-[2-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]ethyl]-6-N-(2-methoxyphenyl)-1,4,5,7-tetrahydropyrazolo[5,4-c]pyridine-3,6-dicarboxamide (PubChem CID 171706350) has the molecular formula C23H22ClF3N6O3 and a molecular weight of 522.92 g/mol. Its IUPAC name is 3-N-[2-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]ethyl]-6-N-(2-methoxyphenyl)-1,4,5,7-tetrahydropyrazolo[5,4-c]pyridine-3,6-dicarboxamide.
| Compound Name | 3-N-[2-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]ethyl]-6-N-(2-methoxyphenyl)-1,4,5,7-tetrahydropyrazolo[5,4-c]pyridine-3,6-dicarboxamide |
|---|---|
| PubChem CID | 171706350 |
| Molecular Formula | C23H22ClF3N6O3 |
| Molecular Weight | 522.92 g/mol |
| Exact Mass | 522.14 |
| IUPAC Name | 3-N-[2-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]ethyl]-6-N-(2-methoxyphenyl)-1,4,5,7-tetrahydropyrazolo[5,4-c]pyridine-3,6-dicarboxamide |
| SMILES | COc1ccccc1NC(=O)N1CCc2c(C(=O)NCCc3ncc(C(F)(F)F)cc3Cl)n[nH]c2C1 |
| InChI | InChI=1S/C23H22ClF3N6O3/c1-36-19-5-3-2-4-17(19)30-22(35)33-9-7-14-18(12-33)31-32-20(14)21(34)28-8-6-16-15(24)10-13(11-29-16)23(25,26)27/h2-5,10-11H,6-9,12H2,1H3,(H,28,34)(H,30,35)(H,31,32) |
| InChIKey | ITVBJLOZRXARKF-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 112.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.92 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |