C22H20FN5O4 — CID 171707356
3-(2,5-dimethyl-1H-imidazol-4-yl)-5-fluoro-N-[4-(5-methyl-1,3,4-oxadiazol-2-yl)phenyl]benzamide;formic acid (PubChem CID 171707356) has the molecular formula C22H20FN5O4 and a molecular weight of 437.43 g/mol. Its IUPAC name is 3-(2,5-dimethyl-1H-imidazol-4-yl)-5-fluoro-N-[4-(5-methyl-1,3,4-oxadiazol-2-yl)phenyl]benzamide;formic acid.
| Compound Name | 3-(2,5-dimethyl-1H-imidazol-4-yl)-5-fluoro-N-[4-(5-methyl-1,3,4-oxadiazol-2-yl)phenyl]benzamide;formic acid |
|---|---|
| PubChem CID | 171707356 |
| Molecular Formula | C22H20FN5O4 |
| Molecular Weight | 437.43 g/mol |
| Exact Mass | 437.15 |
| IUPAC Name | 3-(2,5-dimethyl-1H-imidazol-4-yl)-5-fluoro-N-[4-(5-methyl-1,3,4-oxadiazol-2-yl)phenyl]benzamide;formic acid |
| SMILES | Cc1nc(-c2cc(F)cc(C(=O)Nc3ccc(-c4nnc(C)o4)cc3)c2)c(C)[nH]1.O=CO |
| InChI | InChI=1S/C21H18FN5O2.CH2O2/c1-11-19(24-12(2)23-11)15-8-16(10-17(22)9-15)20(28)25-18-6-4-14(5-7-18)21-27-26-13(3)29-21;2-1-3/h4-10H,1-3H3,(H,23,24)(H,25,28);1H,(H,2,3) |
| InChIKey | UDBLYDJSGRDYRL-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 134.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.43 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|