C16H10F3N3O3 — CID 86789899
2,4,5-trifluoro-3-hydroxy-N-[4-(5-methyl-1,3,4-oxadiazol-2-yl)phenyl]benzamide (PubChem CID 86789899) has the molecular formula C16H10F3N3O3 and a molecular weight of 349.27 g/mol. Its IUPAC name is 2,4,5-trifluoro-3-hydroxy-N-[4-(5-methyl-1,3,4-oxadiazol-2-yl)phenyl]benzamide.
| Compound Name | 2,4,5-trifluoro-3-hydroxy-N-[4-(5-methyl-1,3,4-oxadiazol-2-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 86789899 |
| Molecular Formula | C16H10F3N3O3 |
| Molecular Weight | 349.27 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | 2,4,5-trifluoro-3-hydroxy-N-[4-(5-methyl-1,3,4-oxadiazol-2-yl)phenyl]benzamide |
| SMILES | Cc1nnc(-c2ccc(NC(=O)c3cc(F)c(F)c(O)c3F)cc2)o1 |
| InChI | InChI=1S/C16H10F3N3O3/c1-7-21-22-16(25-7)8-2-4-9(5-3-8)20-15(24)10-6-11(17)13(19)14(23)12(10)18/h2-6,23H,1H3,(H,20,24) |
| InChIKey | DWNHFDBRFSUGPI-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 88.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.27 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|