C27H30N4O2 — CID 171708321
formic acid;4-methyl-6-[2-(4-methylpiperazin-1-yl)ethyl]-2-quinolin-7-ylquinoline (PubChem CID 171708321) has the molecular formula C27H30N4O2 and a molecular weight of 442.56 g/mol. Its IUPAC name is formic acid;4-methyl-6-[2-(4-methylpiperazin-1-yl)ethyl]-2-quinolin-7-ylquinoline.
| Compound Name | formic acid;4-methyl-6-[2-(4-methylpiperazin-1-yl)ethyl]-2-quinolin-7-ylquinoline |
|---|---|
| PubChem CID | 171708321 |
| Molecular Formula | C27H30N4O2 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.24 |
| IUPAC Name | formic acid;4-methyl-6-[2-(4-methylpiperazin-1-yl)ethyl]-2-quinolin-7-ylquinoline |
| SMILES | Cc1cc(-c2ccc3cccnc3c2)nc2ccc(CCN3CCN(C)CC3)cc12.O=CO |
| InChI | InChI=1S/C26H28N4.CH2O2/c1-19-16-26(22-7-6-21-4-3-10-27-25(21)18-22)28-24-8-5-20(17-23(19)24)9-11-30-14-12-29(2)13-15-30;2-1-3/h3-8,10,16-18H,9,11-15H2,1-2H3;1H,(H,2,3) |
| InChIKey | IXIXTCGHGIECGI-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|