C21H34N4O4S — CID 171709055
formic acid;N-[4-(4-methyl-1,4-diazepane-1-carbonyl)cyclohexyl]-3-(2-methyl-1,3-thiazol-4-yl)propanamide (PubChem CID 171709055) has the molecular formula C21H34N4O4S and a molecular weight of 438.59 g/mol. Its IUPAC name is formic acid;N-[4-(4-methyl-1,4-diazepane-1-carbonyl)cyclohexyl]-3-(2-methyl-1,3-thiazol-4-yl)propanamide.
| Compound Name | formic acid;N-[4-(4-methyl-1,4-diazepane-1-carbonyl)cyclohexyl]-3-(2-methyl-1,3-thiazol-4-yl)propanamide |
|---|---|
| PubChem CID | 171709055 |
| Molecular Formula | C21H34N4O4S |
| Molecular Weight | 438.59 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | formic acid;N-[4-(4-methyl-1,4-diazepane-1-carbonyl)cyclohexyl]-3-(2-methyl-1,3-thiazol-4-yl)propanamide |
| SMILES | Cc1nc(CCC(=O)NC2CCC(C(=O)N3CCCN(C)CC3)CC2)cs1.O=CO |
| InChI | InChI=1S/C20H32N4O2S.CH2O2/c1-15-21-18(14-27-15)8-9-19(25)22-17-6-4-16(5-7-17)20(26)24-11-3-10-23(2)12-13-24;2-1-3/h14,16-17H,3-13H2,1-2H3,(H,22,25);1H,(H,2,3) |
| InChIKey | NZSCKDZVUPBQJT-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 102.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.59 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|