C24H37N3O5 — CID 163341722
formic acid;N-[(1R,2R,4S)-2-hydroxy-4-(4-methyl-1,4-diazepane-1-carbonyl)cyclohexyl]-4-phenylbutanamide (PubChem CID 163341722) has the molecular formula C24H37N3O5 and a molecular weight of 447.58 g/mol. Its IUPAC name is formic acid;N-[(1R,2R,4S)-2-hydroxy-4-(4-methyl-1,4-diazepane-1-carbonyl)cyclohexyl]-4-phenylbutanamide.
| Compound Name | formic acid;N-[(1R,2R,4S)-2-hydroxy-4-(4-methyl-1,4-diazepane-1-carbonyl)cyclohexyl]-4-phenylbutanamide |
|---|---|
| PubChem CID | 163341722 |
| Molecular Formula | C24H37N3O5 |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.27 |
| IUPAC Name | formic acid;N-[(1R,2R,4S)-2-hydroxy-4-(4-methyl-1,4-diazepane-1-carbonyl)cyclohexyl]-4-phenylbutanamide |
| SMILES | CN1CCCN(C(=O)[C@H]2CC[C@@H](NC(=O)CCCc3ccccc3)[C@H](O)C2)CC1.O=CO |
| InChI | InChI=1S/C23H35N3O3.CH2O2/c1-25-13-6-14-26(16-15-25)23(29)19-11-12-20(21(27)17-19)24-22(28)10-5-9-18-7-3-2-4-8-18;2-1-3/h2-4,7-8,19-21,27H,5-6,9-17H2,1H3,(H,24,28);1H,(H,2,3)/t19-,20+,21+;/m0./s1 |
| InChIKey | LMTPQUGTWITPLD-HWAJWLCKSA-N |
| XLogP | 1.52 |
| TPSA | 110.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|