C23H35N3O5 — CID 171712151
formic acid;N-[[(2S,5R)-1-methyl-5-(2-morpholin-4-yl-2-oxoethyl)pyrrolidin-2-yl]methyl]-4-phenylbutanamide (PubChem CID 171712151) has the molecular formula C23H35N3O5 and a molecular weight of 433.55 g/mol. Its IUPAC name is formic acid;N-[[(2S,5R)-1-methyl-5-(2-morpholin-4-yl-2-oxoethyl)pyrrolidin-2-yl]methyl]-4-phenylbutanamide.
| Compound Name | formic acid;N-[[(2S,5R)-1-methyl-5-(2-morpholin-4-yl-2-oxoethyl)pyrrolidin-2-yl]methyl]-4-phenylbutanamide |
|---|---|
| PubChem CID | 171712151 |
| Molecular Formula | C23H35N3O5 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.26 |
| IUPAC Name | formic acid;N-[[(2S,5R)-1-methyl-5-(2-morpholin-4-yl-2-oxoethyl)pyrrolidin-2-yl]methyl]-4-phenylbutanamide |
| SMILES | CN1[C@@H](CC(=O)N2CCOCC2)CC[C@H]1CNC(=O)CCCc1ccccc1.O=CO |
| InChI | InChI=1S/C22H33N3O3.CH2O2/c1-24-19(16-22(27)25-12-14-28-15-13-25)10-11-20(24)17-23-21(26)9-5-8-18-6-3-2-4-7-18;2-1-3/h2-4,6-7,19-20H,5,8-17H2,1H3,(H,23,26);1H,(H,2,3)/t19-,20+;/m1./s1 |
| InChIKey | QOCSKXDNKKMWOI-FDOHDBATSA-N |
| XLogP | 1.54 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|