C21H29N3O3 — CID 165426080
(E)-N-[[(2S,5R)-1-methyl-5-(2-morpholin-4-yl-2-oxoethyl)pyrrolidin-2-yl]methyl]-3-phenylprop-2-enamide (PubChem CID 165426080) has the molecular formula C21H29N3O3 and a molecular weight of 371.48 g/mol. Its IUPAC name is (E)-N-[[(2S,5R)-1-methyl-5-(2-morpholin-4-yl-2-oxoethyl)pyrrolidin-2-yl]methyl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[[(2S,5R)-1-methyl-5-(2-morpholin-4-yl-2-oxoethyl)pyrrolidin-2-yl]methyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 165426080 |
| Molecular Formula | C21H29N3O3 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.22 |
| IUPAC Name | (E)-N-[[(2S,5R)-1-methyl-5-(2-morpholin-4-yl-2-oxoethyl)pyrrolidin-2-yl]methyl]-3-phenylprop-2-enamide |
| SMILES | CN1[C@@H](CC(=O)N2CCOCC2)CC[C@H]1CNC(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C21H29N3O3/c1-23-18(15-21(26)24-11-13-27-14-12-24)8-9-19(23)16-22-20(25)10-7-17-5-3-2-4-6-17/h2-7,10,18-19H,8-9,11-16H2,1H3,(H,22,25)/b10-7+/t18-,19+/m1/s1 |
| InChIKey | FLPVCOGBTZTUAC-PDBZHATLSA-N |
| XLogP | 1.53 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|