C20H26ClN3O3 — CID 171709068
[(1S,3S,4S)-3-amino-4-hydroxycyclopentyl]-[2-(2-phenylethyl)-6,7-dihydro-4H-[1,3]oxazolo[4,5-c]pyridin-5-yl]methanone;hydrochloride (PubChem CID 171709068) has the molecular formula C20H26ClN3O3 and a molecular weight of 391.90 g/mol. Its IUPAC name is [(1S,3S,4S)-3-amino-4-hydroxycyclopentyl]-[2-(2-phenylethyl)-6,7-dihydro-4H-[1,3]oxazolo[4,5-c]pyridin-5-yl]methanone;hydrochloride.
| Compound Name | [(1S,3S,4S)-3-amino-4-hydroxycyclopentyl]-[2-(2-phenylethyl)-6,7-dihydro-4H-[1,3]oxazolo[4,5-c]pyridin-5-yl]methanone;hydrochloride |
|---|---|
| PubChem CID | 171709068 |
| Molecular Formula | C20H26ClN3O3 |
| Molecular Weight | 391.90 g/mol |
| Exact Mass | 391.17 |
| IUPAC Name | [(1S,3S,4S)-3-amino-4-hydroxycyclopentyl]-[2-(2-phenylethyl)-6,7-dihydro-4H-[1,3]oxazolo[4,5-c]pyridin-5-yl]methanone;hydrochloride |
| SMILES | Cl.N[C@H]1C[C@H](C(=O)N2CCc3oc(CCc4ccccc4)nc3C2)C[C@@H]1O |
| InChI | InChI=1S/C20H25N3O3.ClH/c21-15-10-14(11-17(15)24)20(25)23-9-8-18-16(12-23)22-19(26-18)7-6-13-4-2-1-3-5-13;/h1-5,14-15,17,24H,6-12,21H2;1H/t14-,15-,17-;/m0./s1 |
| InChIKey | KUOJUPZYWXMZKD-HAGMFFOZSA-N |
| XLogP | 1.86 |
| TPSA | 92.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.90 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |