C24H33N3O3 — CID 170505005
[(1S,3R,4R)-3-amino-4-propoxycyclohexyl]-[2-(2-phenylethyl)-6,7-dihydro-4H-[1,3]oxazolo[4,5-c]pyridin-5-yl]methanone (PubChem CID 170505005) has the molecular formula C24H33N3O3 and a molecular weight of 411.55 g/mol. Its IUPAC name is [(1S,3R,4R)-3-amino-4-propoxycyclohexyl]-[2-(2-phenylethyl)-6,7-dihydro-4H-[1,3]oxazolo[4,5-c]pyridin-5-yl]methanone.
| Compound Name | [(1S,3R,4R)-3-amino-4-propoxycyclohexyl]-[2-(2-phenylethyl)-6,7-dihydro-4H-[1,3]oxazolo[4,5-c]pyridin-5-yl]methanone |
|---|---|
| PubChem CID | 170505005 |
| Molecular Formula | C24H33N3O3 |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.25 |
| IUPAC Name | [(1S,3R,4R)-3-amino-4-propoxycyclohexyl]-[2-(2-phenylethyl)-6,7-dihydro-4H-[1,3]oxazolo[4,5-c]pyridin-5-yl]methanone |
| SMILES | CCCO[C@@H]1CC[C@H](C(=O)N2CCc3oc(CCc4ccccc4)nc3C2)C[C@H]1N |
| InChI | InChI=1S/C24H33N3O3/c1-2-14-29-21-10-9-18(15-19(21)25)24(28)27-13-12-22-20(16-27)26-23(30-22)11-8-17-6-4-3-5-7-17/h3-7,18-19,21H,2,8-16,25H2,1H3/t18-,19+,21+/m0/s1 |
| InChIKey | CYCDXIFNMHYHSM-QKNQBKEWSA-N |
| XLogP | 3.27 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |