C22H29N3O3 — CID 170502315
[(1S,3R,4R)-4-amino-3-propoxycyclohexyl]-(2-phenyl-6,7-dihydro-4H-[1,3]oxazolo[4,5-c]pyridin-5-yl)methanone (PubChem CID 170502315) has the molecular formula C22H29N3O3 and a molecular weight of 383.49 g/mol. Its IUPAC name is [(1S,3R,4R)-4-amino-3-propoxycyclohexyl]-(2-phenyl-6,7-dihydro-4H-[1,3]oxazolo[4,5-c]pyridin-5-yl)methanone.
| Compound Name | [(1S,3R,4R)-4-amino-3-propoxycyclohexyl]-(2-phenyl-6,7-dihydro-4H-[1,3]oxazolo[4,5-c]pyridin-5-yl)methanone |
|---|---|
| PubChem CID | 170502315 |
| Molecular Formula | C22H29N3O3 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.22 |
| IUPAC Name | [(1S,3R,4R)-4-amino-3-propoxycyclohexyl]-(2-phenyl-6,7-dihydro-4H-[1,3]oxazolo[4,5-c]pyridin-5-yl)methanone |
| SMILES | CCCO[C@@H]1C[C@@H](C(=O)N2CCc3oc(-c4ccccc4)nc3C2)CC[C@H]1N |
| InChI | InChI=1S/C22H29N3O3/c1-2-12-27-20-13-16(8-9-17(20)23)22(26)25-11-10-19-18(14-25)24-21(28-19)15-6-4-3-5-7-15/h3-7,16-17,20H,2,8-14,23H2,1H3/t16-,17+,20+/m0/s1 |
| InChIKey | ZNHMLMPDLQNTJQ-SQGPQFPESA-N |
| XLogP | 3.15 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |