C20H24ClF2N3O3 — CID 171710794
[(1S,3R,4R)-3-amino-4-methoxycyclohexyl]-[2-(3,5-difluorophenyl)-6,7-dihydro-4H-[1,3]oxazolo[4,5-c]pyridin-5-yl]methanone;hydrochloride (PubChem CID 171710794) has the molecular formula C20H24ClF2N3O3 and a molecular weight of 427.88 g/mol. Its IUPAC name is [(1S,3R,4R)-3-amino-4-methoxycyclohexyl]-[2-(3,5-difluorophenyl)-6,7-dihydro-4H-[1,3]oxazolo[4,5-c]pyridin-5-yl]methanone;hydrochloride.
| Compound Name | [(1S,3R,4R)-3-amino-4-methoxycyclohexyl]-[2-(3,5-difluorophenyl)-6,7-dihydro-4H-[1,3]oxazolo[4,5-c]pyridin-5-yl]methanone;hydrochloride |
|---|---|
| PubChem CID | 171710794 |
| Molecular Formula | C20H24ClF2N3O3 |
| Molecular Weight | 427.88 g/mol |
| Exact Mass | 427.15 |
| IUPAC Name | [(1S,3R,4R)-3-amino-4-methoxycyclohexyl]-[2-(3,5-difluorophenyl)-6,7-dihydro-4H-[1,3]oxazolo[4,5-c]pyridin-5-yl]methanone;hydrochloride |
| SMILES | CO[C@@H]1CC[C@H](C(=O)N2CCc3oc(-c4cc(F)cc(F)c4)nc3C2)C[C@H]1N.Cl |
| InChI | InChI=1S/C20H23F2N3O3.ClH/c1-27-17-3-2-11(8-15(17)23)20(26)25-5-4-18-16(10-25)24-19(28-18)12-6-13(21)9-14(22)7-12;/h6-7,9,11,15,17H,2-5,8,10,23H2,1H3;1H/t11-,15+,17+;/m0./s1 |
| InChIKey | YOILVISXRMNQID-FYCRXMNZSA-N |
| XLogP | 3.07 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.88 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |