C19H21F2N3O3 — CID 170503658
[(1S,3S,4S)-4-amino-3-hydroxycyclohexyl]-[2-(3,5-difluorophenyl)-6,7-dihydro-4H-[1,3]oxazolo[4,5-c]pyridin-5-yl]methanone (PubChem CID 170503658) has the molecular formula C19H21F2N3O3 and a molecular weight of 377.39 g/mol. Its IUPAC name is [(1S,3S,4S)-4-amino-3-hydroxycyclohexyl]-[2-(3,5-difluorophenyl)-6,7-dihydro-4H-[1,3]oxazolo[4,5-c]pyridin-5-yl]methanone.
| Compound Name | [(1S,3S,4S)-4-amino-3-hydroxycyclohexyl]-[2-(3,5-difluorophenyl)-6,7-dihydro-4H-[1,3]oxazolo[4,5-c]pyridin-5-yl]methanone |
|---|---|
| PubChem CID | 170503658 |
| Molecular Formula | C19H21F2N3O3 |
| Molecular Weight | 377.39 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | [(1S,3S,4S)-4-amino-3-hydroxycyclohexyl]-[2-(3,5-difluorophenyl)-6,7-dihydro-4H-[1,3]oxazolo[4,5-c]pyridin-5-yl]methanone |
| SMILES | N[C@H]1CC[C@H](C(=O)N2CCc3oc(-c4cc(F)cc(F)c4)nc3C2)C[C@@H]1O |
| InChI | InChI=1S/C19H21F2N3O3/c20-12-5-11(6-13(21)8-12)18-23-15-9-24(4-3-17(15)27-18)19(26)10-1-2-14(22)16(25)7-10/h5-6,8,10,14,16,25H,1-4,7,9,22H2/t10-,14-,16-/m0/s1 |
| InChIKey | FFLNINKFEDQXIZ-FSBGKCOPSA-N |
| XLogP | 1.99 |
| TPSA | 92.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.39 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |