C19H25FN2O3 — CID 171710230
4-[[3-[(3-fluoro-4-methylphenyl)methyl]pyrrolidin-1-yl]methyl]-3,5-dimethyl-1,2-oxazole;formic acid (PubChem CID 171710230) has the molecular formula C19H25FN2O3 and a molecular weight of 348.42 g/mol. Its IUPAC name is 4-[[3-[(3-fluoro-4-methylphenyl)methyl]pyrrolidin-1-yl]methyl]-3,5-dimethyl-1,2-oxazole;formic acid.
| Compound Name | 4-[[3-[(3-fluoro-4-methylphenyl)methyl]pyrrolidin-1-yl]methyl]-3,5-dimethyl-1,2-oxazole;formic acid |
|---|---|
| PubChem CID | 171710230 |
| Molecular Formula | C19H25FN2O3 |
| Molecular Weight | 348.42 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | 4-[[3-[(3-fluoro-4-methylphenyl)methyl]pyrrolidin-1-yl]methyl]-3,5-dimethyl-1,2-oxazole;formic acid |
| SMILES | Cc1ccc(CC2CCN(Cc3c(C)noc3C)C2)cc1F.O=CO |
| InChI | InChI=1S/C18H23FN2O.CH2O2/c1-12-4-5-15(9-18(12)19)8-16-6-7-21(10-16)11-17-13(2)20-22-14(17)3;2-1-3/h4-5,9,16H,6-8,10-11H2,1-3H3;1H,(H,2,3) |
| InChIKey | LBAVUWJVLPBNPL-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 66.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.42 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|