C22H25FN2O5 — CID 171710314
formic acid;methyl 3-[[1-[2-(2-fluoroanilino)-2-oxoethyl]pyrrolidin-3-yl]methyl]benzoate (PubChem CID 171710314) has the molecular formula C22H25FN2O5 and a molecular weight of 416.45 g/mol. Its IUPAC name is formic acid;methyl 3-[[1-[2-(2-fluoroanilino)-2-oxoethyl]pyrrolidin-3-yl]methyl]benzoate.
| Compound Name | formic acid;methyl 3-[[1-[2-(2-fluoroanilino)-2-oxoethyl]pyrrolidin-3-yl]methyl]benzoate |
|---|---|
| PubChem CID | 171710314 |
| Molecular Formula | C22H25FN2O5 |
| Molecular Weight | 416.45 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | formic acid;methyl 3-[[1-[2-(2-fluoroanilino)-2-oxoethyl]pyrrolidin-3-yl]methyl]benzoate |
| SMILES | COC(=O)c1cccc(CC2CCN(CC(=O)Nc3ccccc3F)C2)c1.O=CO |
| InChI | InChI=1S/C21H23FN2O3.CH2O2/c1-27-21(26)17-6-4-5-15(12-17)11-16-9-10-24(13-16)14-20(25)23-19-8-3-2-7-18(19)22;2-1-3/h2-8,12,16H,9-11,13-14H2,1H3,(H,23,25);1H,(H,2,3) |
| InChIKey | BRWGQRQLIKPOFJ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.45 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|