About formic acid;methyl 3-[[1-[2-(carbamoylamino)acetyl]pyrrolidin-3-yl]methyl]benzoate
formic acid;methyl 3-[[1-[2-(carbamoylamino)acetyl]pyrrolidin-3-yl]methyl]benzoate (PubChem CID 171330591) has the molecular formula C17H23N3O6
and a molecular weight of 365.39 g/mol. Its IUPAC name is formic acid;methyl 3-[[1-[2-(carbamoylamino)acetyl]pyrrolidin-3-yl]methyl]benzoate.
Molecular Properties
| Compound Name | formic acid;methyl 3-[[1-[2-(carbamoylamino)acetyl]pyrrolidin-3-yl]methyl]benzoate |
| PubChem CID | 171330591 |
| Molecular Formula | C17H23N3O6 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | formic acid;methyl 3-[[1-[2-(carbamoylamino)acetyl]pyrrolidin-3-yl]methyl]benzoate |
| SMILES | COC(=O)c1cccc(CC2CCN(C(=O)CNC(N)=O)C2)c1.O=CO |
| InChI | InChI=1S/C16H21N3O4.CH2O2/c1-23-15(21)13-4-2-3-11(8-13)7-12-5-6-19(10-12)14(20)9-18-16(17)22;2-1-3/h2-4,8,12H,5-7,9-10H2,1H3,(H3,17,18,22);1H,(H,2,3) |
| InChIKey | ZGYDPISSPNTABE-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 139.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze formic acid;methyl 3-[[1-[2-(carbamoylamino)acetyl]pyrrolidin-3-yl]methyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formic acid;methyl 3-[[1-[2-(carbamoylamino)acetyl]pyrrolidin-3-yl]methyl]benzoate?
The IUPAC name of formic acid;methyl 3-[[1-[2-(carbamoylamino)acetyl]pyrrolidin-3-yl]methyl]benzoate (CID 171330591) is formic acid;methyl 3-[[1-[2-(carbamoylamino)acetyl]pyrrolidin-3-yl]methyl]benzoate.
What is the SMILES notation for formic acid;methyl 3-[[1-[2-(carbamoylamino)acetyl]pyrrolidin-3-yl]methyl]benzoate?
The canonical SMILES for formic acid;methyl 3-[[1-[2-(carbamoylamino)acetyl]pyrrolidin-3-yl]methyl]benzoate is COC(=O)c1cccc(CC2CCN(C(=O)CNC(N)=O)C2)c1.O=CO.
What is the InChIKey of formic acid;methyl 3-[[1-[2-(carbamoylamino)acetyl]pyrrolidin-3-yl]methyl]benzoate?
The InChIKey is ZGYDPISSPNTABE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21N3O4.CH2O2/c1-23-15(21)13-4-2-3-11(8-13)7-12-5-6-19(10-12)14(20)9-18-16(17)22;2-1-3/h2-4,8,12H,5-7,9-10H2,1H3,(H3,17,18,22);1H,(H,2,3).
What are the key properties of formic acid;methyl 3-[[1-[2-(carbamoylamino)acetyl]pyrrolidin-3-yl]methyl]benzoate?
formic acid;methyl 3-[[1-[2-(carbamoylamino)acetyl]pyrrolidin-3-yl]methyl]benzoate has a molecular weight of 365.39 g/mol, XLogP of 0.23, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for formic acid;methyl 3-[[1-[2-(carbamoylamino)acetyl]pyrrolidin-3-yl]methyl]benzoate is sourced from PubChem (CID 171330591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).