C23H34N4O5 — CID 171710571
formic acid;N-[[(2R,5S)-5-[2-[6-(4-methoxyphenyl)-2,6-diazaspiro[3.3]heptan-2-yl]-2-oxoethyl]-1-methylpyrrolidin-2-yl]methyl]acetamide (PubChem CID 171710571) has the molecular formula C23H34N4O5 and a molecular weight of 446.55 g/mol. Its IUPAC name is formic acid;N-[[(2R,5S)-5-[2-[6-(4-methoxyphenyl)-2,6-diazaspiro[3.3]heptan-2-yl]-2-oxoethyl]-1-methylpyrrolidin-2-yl]methyl]acetamide.
| Compound Name | formic acid;N-[[(2R,5S)-5-[2-[6-(4-methoxyphenyl)-2,6-diazaspiro[3.3]heptan-2-yl]-2-oxoethyl]-1-methylpyrrolidin-2-yl]methyl]acetamide |
|---|---|
| PubChem CID | 171710571 |
| Molecular Formula | C23H34N4O5 |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.25 |
| IUPAC Name | formic acid;N-[[(2R,5S)-5-[2-[6-(4-methoxyphenyl)-2,6-diazaspiro[3.3]heptan-2-yl]-2-oxoethyl]-1-methylpyrrolidin-2-yl]methyl]acetamide |
| SMILES | COc1ccc(N2CC3(CN(C(=O)C[C@@H]4CC[C@H](CNC(C)=O)N4C)C3)C2)cc1.O=CO |
| InChI | InChI=1S/C22H32N4O3.CH2O2/c1-16(27)23-11-19-5-4-18(24(19)2)10-21(28)26-14-22(15-26)12-25(13-22)17-6-8-20(29-3)9-7-17;2-1-3/h6-9,18-19H,4-5,10-15H2,1-3H3,(H,23,27);1H,(H,2,3)/t18-,19+;/m0./s1 |
| InChIKey | YKNYLXWVMJXULF-GRTNUQQKSA-N |
| XLogP | 1.03 |
| TPSA | 102.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|