C19H31N5O5 — CID 171713420
N-[(3R,4S)-3-ethyl-1-(2-morpholin-4-yl-2-oxoethyl)piperidin-4-yl]-3-methylimidazole-4-carboxamide;formic acid (PubChem CID 171713420) has the molecular formula C19H31N5O5 and a molecular weight of 409.49 g/mol. Its IUPAC name is N-[(3R,4S)-3-ethyl-1-(2-morpholin-4-yl-2-oxoethyl)piperidin-4-yl]-3-methylimidazole-4-carboxamide;formic acid.
| Compound Name | N-[(3R,4S)-3-ethyl-1-(2-morpholin-4-yl-2-oxoethyl)piperidin-4-yl]-3-methylimidazole-4-carboxamide;formic acid |
|---|---|
| PubChem CID | 171713420 |
| Molecular Formula | C19H31N5O5 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.23 |
| IUPAC Name | N-[(3R,4S)-3-ethyl-1-(2-morpholin-4-yl-2-oxoethyl)piperidin-4-yl]-3-methylimidazole-4-carboxamide;formic acid |
| SMILES | CC[C@@H]1CN(CC(=O)N2CCOCC2)CC[C@@H]1NC(=O)c1cncn1C.O=CO |
| InChI | InChI=1S/C18H29N5O3.CH2O2/c1-3-14-11-22(12-17(24)23-6-8-26-9-7-23)5-4-15(14)20-18(25)16-10-19-13-21(16)2;2-1-3/h10,13-15H,3-9,11-12H2,1-2H3,(H,20,25);1H,(H,2,3)/t14-,15+;/m1./s1 |
| InChIKey | BTOZPGAWKZBANB-LIOBNPLQSA-N |
| XLogP | -0.19 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|