C32H27N5O4 — CID 171714521
ethyl N-[2-[[(E)-3-[4-[(1-phenylbenzimidazole-5-carbonyl)amino]phenyl]prop-2-enoyl]amino]phenyl]carbamate (PubChem CID 171714521) has the molecular formula C32H27N5O4 and a molecular weight of 545.60 g/mol. Its IUPAC name is ethyl N-[2-[[(E)-3-[4-[(1-phenylbenzimidazole-5-carbonyl)amino]phenyl]prop-2-enoyl]amino]phenyl]carbamate.
| Compound Name | ethyl N-[2-[[(E)-3-[4-[(1-phenylbenzimidazole-5-carbonyl)amino]phenyl]prop-2-enoyl]amino]phenyl]carbamate |
|---|---|
| PubChem CID | 171714521 |
| Molecular Formula | C32H27N5O4 |
| Molecular Weight | 545.60 g/mol |
| Exact Mass | 545.21 |
| IUPAC Name | ethyl N-[2-[[(E)-3-[4-[(1-phenylbenzimidazole-5-carbonyl)amino]phenyl]prop-2-enoyl]amino]phenyl]carbamate |
| SMILES | CCOC(=O)Nc1ccccc1NC(=O)/C=C/c1ccc(NC(=O)c2ccc3c(c2)ncn3-c2ccccc2)cc1 |
| InChI | InChI=1S/C32H27N5O4/c1-2-41-32(40)36-27-11-7-6-10-26(27)35-30(38)19-14-22-12-16-24(17-13-22)34-31(39)23-15-18-29-28(20-23)33-21-37(29)25-8-4-3-5-9-25/h3-21H,2H2,1H3,(H,34,39)(H,35,38)(H,36,40)/b19-14+ |
| InChIKey | UMTXNYWOAWTNID-XMHGGMMESA-N |
| XLogP | 6.50 |
| TPSA | 114.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.60 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|