C8H18BNO5S — CID 171717109
2-(2-methylpropyl)-2-(oxoboranylsulfonylmethylamino)propane-1,3-diol (PubChem CID 171717109) has the molecular formula C8H18BNO5S and a molecular weight of 251.11 g/mol. Its IUPAC name is 2-(2-methylpropyl)-2-(oxoboranylsulfonylmethylamino)propane-1,3-diol.
| Compound Name | 2-(2-methylpropyl)-2-(oxoboranylsulfonylmethylamino)propane-1,3-diol |
|---|---|
| PubChem CID | 171717109 |
| Molecular Formula | C8H18BNO5S |
| Molecular Weight | 251.11 g/mol |
| Exact Mass | 251.10 |
| IUPAC Name | 2-(2-methylpropyl)-2-(oxoboranylsulfonylmethylamino)propane-1,3-diol |
| SMILES | CC(C)CC(CO)(CO)NCS(=O)(=O)B=O |
| InChI | InChI=1S/C8H18BNO5S/c1-7(2)3-8(4-11,5-12)10-6-16(14,15)9-13/h7,10-12H,3-6H2,1-2H3 |
| InChIKey | AXCOXJRODCMMAJ-UHFFFAOYSA-N |
| XLogP | -1.32 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.11 |
| LogP ≤ 5 | -1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|