C27H29N9O6 — CID 171717189
(11R)-11-[3-(4-carbamoyl-2-nitroanilino)propyl]-2-[(2-ethyl-5-methylpyrazole-3-carbonyl)amino]-9-oxa-1,3-diazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraene-6-carboxamide (PubChem CID 171717189) has the molecular formula C27H29N9O6 and a molecular weight of 575.59 g/mol. Its IUPAC name is (11R)-11-[3-(4-carbamoyl-2-nitroanilino)propyl]-2-[(2-ethyl-5-methylpyrazole-3-carbonyl)amino]-9-oxa-1,3-diazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraene-6-carboxamide.
| Compound Name | (11R)-11-[3-(4-carbamoyl-2-nitroanilino)propyl]-2-[(2-ethyl-5-methylpyrazole-3-carbonyl)amino]-9-oxa-1,3-diazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraene-6-carboxamide |
|---|---|
| PubChem CID | 171717189 |
| Molecular Formula | C27H29N9O6 |
| Molecular Weight | 575.59 g/mol |
| Exact Mass | 575.22 |
| IUPAC Name | (11R)-11-[3-(4-carbamoyl-2-nitroanilino)propyl]-2-[(2-ethyl-5-methylpyrazole-3-carbonyl)amino]-9-oxa-1,3-diazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraene-6-carboxamide |
| SMILES | CCn1nc(C)cc1C(=O)Nc1nc2cc(C(N)=O)cc3c2n1[C@H](CCCNc1ccc(C(N)=O)cc1[N+](=O)[O-])CO3 |
| InChI | InChI=1S/C27H29N9O6/c1-3-34-21(9-14(2)33-34)26(39)32-27-31-19-10-16(25(29)38)12-22-23(19)35(27)17(13-42-22)5-4-8-30-18-7-6-15(24(28)37)11-20(18)36(40)41/h6-7,9-12,17,30H,3-5,8,13H2,1-2H3,(H2,28,37)(H2,29,38)(H,31,32,39)/t17-/m1/s1 |
| InChIKey | OFRRGZJMHJOZDU-QGZVFWFLSA-N |
| XLogP | 2.75 |
| TPSA | 215.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.59 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|