C28H54N2O4 — CID 171721083
3-[2-[2-carboxyethyl-[(Z)-octadec-9-enyl]amino]ethyl-ethylamino]propanoic acid (PubChem CID 171721083) has the molecular formula C28H54N2O4 and a molecular weight of 482.75 g/mol. Its IUPAC name is 3-[2-[2-carboxyethyl-[(Z)-octadec-9-enyl]amino]ethyl-ethylamino]propanoic acid.
| Compound Name | 3-[2-[2-carboxyethyl-[(Z)-octadec-9-enyl]amino]ethyl-ethylamino]propanoic acid |
|---|---|
| PubChem CID | 171721083 |
| Molecular Formula | C28H54N2O4 |
| Molecular Weight | 482.75 g/mol |
| Exact Mass | 482.41 |
| IUPAC Name | 3-[2-[2-carboxyethyl-[(Z)-octadec-9-enyl]amino]ethyl-ethylamino]propanoic acid |
| SMILES | CCCCCCCC/C=C\CCCCCCCCN(CCC(=O)O)CCN(CC)CCC(=O)O |
| InChI | InChI=1S/C28H54N2O4/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-22-30(24-21-28(33)34)26-25-29(4-2)23-20-27(31)32/h11-12H,3-10,13-26H2,1-2H3,(H,31,32)(H,33,34)/b12-11- |
| InChIKey | MWSFLUFUKFFZKL-QXMHVHEDSA-N |
| XLogP | 6.60 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.75 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|