C14H13IO6S2 — CID 171721679
4-(2-iodophenyl)sulfonyloxy-3,5-dimethylbenzenesulfonic acid (PubChem CID 171721679) has the molecular formula C14H13IO6S2 and a molecular weight of 468.29 g/mol. Its IUPAC name is 4-(2-iodophenyl)sulfonyloxy-3,5-dimethylbenzenesulfonic acid.
| Compound Name | 4-(2-iodophenyl)sulfonyloxy-3,5-dimethylbenzenesulfonic acid |
|---|---|
| PubChem CID | 171721679 |
| Molecular Formula | C14H13IO6S2 |
| Molecular Weight | 468.29 g/mol |
| Exact Mass | 467.92 |
| IUPAC Name | 4-(2-iodophenyl)sulfonyloxy-3,5-dimethylbenzenesulfonic acid |
| SMILES | Cc1cc(S(=O)(=O)O)cc(C)c1OS(=O)(=O)c1ccccc1I |
| InChI | InChI=1S/C14H13IO6S2/c1-9-7-11(22(16,17)18)8-10(2)14(9)21-23(19,20)13-6-4-3-5-12(13)15/h3-8H,1-2H3,(H,16,17,18) |
| InChIKey | WHOYJNSRVHOIBW-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.29 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|