C25H22F3O4S+ — CID 171721831
[4-[2-oxo-2-(1,1,1-trifluoro-2-methylpropan-2-yl)oxyethoxy]carbonylphenyl]-diphenylsulfanium (PubChem CID 171721831) has the molecular formula C25H22F3O4S+ and a molecular weight of 475.51 g/mol. Its IUPAC name is [4-[2-oxo-2-(1,1,1-trifluoro-2-methylpropan-2-yl)oxyethoxy]carbonylphenyl]-diphenylsulfanium.
| Compound Name | [4-[2-oxo-2-(1,1,1-trifluoro-2-methylpropan-2-yl)oxyethoxy]carbonylphenyl]-diphenylsulfanium |
|---|---|
| PubChem CID | 171721831 |
| Molecular Formula | C25H22F3O4S+ |
| Molecular Weight | 475.51 g/mol |
| Exact Mass | 475.12 |
| IUPAC Name | [4-[2-oxo-2-(1,1,1-trifluoro-2-methylpropan-2-yl)oxyethoxy]carbonylphenyl]-diphenylsulfanium |
| SMILES | CC(C)(OC(=O)COC(=O)c1ccc([S+](c2ccccc2)c2ccccc2)cc1)C(F)(F)F |
| InChI | InChI=1S/C25H22F3O4S/c1-24(2,25(26,27)28)32-22(29)17-31-23(30)18-13-15-21(16-14-18)33(19-9-5-3-6-10-19)20-11-7-4-8-12-20/h3-16H,17H2,1-2H3/q+1 |
| InChIKey | QLLJPYUVSPNXIT-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.51 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|