C17H13N5O2 — CID 171726252
8-(3-methylanilino)-2,4,7,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene-5-carboxylic acid (PubChem CID 171726252) has the molecular formula C17H13N5O2 and a molecular weight of 319.32 g/mol. Its IUPAC name is 8-(3-methylanilino)-2,4,7,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene-5-carboxylic acid.
| Compound Name | 8-(3-methylanilino)-2,4,7,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene-5-carboxylic acid |
|---|---|
| PubChem CID | 171726252 |
| Molecular Formula | C17H13N5O2 |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | 8-(3-methylanilino)-2,4,7,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene-5-carboxylic acid |
| SMILES | Cc1cccc(Nc2nc3c(C(=O)O)ncn3c3cnccc23)c1 |
| InChI | InChI=1S/C17H13N5O2/c1-10-3-2-4-11(7-10)20-15-12-5-6-18-8-13(12)22-9-19-14(17(23)24)16(22)21-15/h2-9H,1H3,(H,20,21)(H,23,24) |
| InChIKey | CWDGDNKKFXJSQG-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 92.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |