C17H13N5O3 — CID 171726236
8-(4-methoxyanilino)-2,4,7,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene-5-carboxylic acid (PubChem CID 171726236) has the molecular formula C17H13N5O3 and a molecular weight of 335.32 g/mol. Its IUPAC name is 8-(4-methoxyanilino)-2,4,7,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene-5-carboxylic acid.
| Compound Name | 8-(4-methoxyanilino)-2,4,7,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene-5-carboxylic acid |
|---|---|
| PubChem CID | 171726236 |
| Molecular Formula | C17H13N5O3 |
| Molecular Weight | 335.32 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | 8-(4-methoxyanilino)-2,4,7,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene-5-carboxylic acid |
| SMILES | COc1ccc(Nc2nc3c(C(=O)O)ncn3c3cnccc23)cc1 |
| InChI | InChI=1S/C17H13N5O3/c1-25-11-4-2-10(3-5-11)20-15-12-6-7-18-8-13(12)22-9-19-14(17(23)24)16(22)21-15/h2-9H,1H3,(H,20,21)(H,23,24) |
| InChIKey | BGAWPLXPVONTHA-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 101.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.32 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |