C13H13ClN3OS+ — CID 171731788
[5-chloro-6-(1,3-thiazol-4-ylmethoxy)-1H-indol-2-yl]methylazanium (PubChem CID 171731788) has the molecular formula C13H13ClN3OS+ and a molecular weight of 294.79 g/mol. Its IUPAC name is [5-chloro-6-(1,3-thiazol-4-ylmethoxy)-1H-indol-2-yl]methylazanium.
| Compound Name | [5-chloro-6-(1,3-thiazol-4-ylmethoxy)-1H-indol-2-yl]methylazanium |
|---|---|
| PubChem CID | 171731788 |
| Molecular Formula | C13H13ClN3OS+ |
| Molecular Weight | 294.79 g/mol |
| Exact Mass | 294.05 |
| IUPAC Name | [5-chloro-6-(1,3-thiazol-4-ylmethoxy)-1H-indol-2-yl]methylazanium |
| SMILES | [NH3+]Cc1cc2cc(Cl)c(OCc3cscn3)cc2[nH]1 |
| InChI | InChI=1S/C13H12ClN3OS/c14-11-2-8-1-9(4-15)17-12(8)3-13(11)18-5-10-6-19-7-16-10/h1-3,6-7,17H,4-5,15H2/p+1 |
| InChIKey | KERDDMCHGYKMFJ-UHFFFAOYSA-O |
| XLogP | 2.60 |
| TPSA | 65.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.79 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |