About [5-chloro-3-ethyl-6-(1,3-thiazol-4-ylmethoxy)-1H-indol-2-yl]methylcarbamic acid
[5-chloro-3-ethyl-6-(1,3-thiazol-4-ylmethoxy)-1H-indol-2-yl]methylcarbamic acid (PubChem CID 174242689) has the molecular formula C16H16ClN3O3S
and a molecular weight of 365.84 g/mol. Its IUPAC name is [5-chloro-3-ethyl-6-(1,3-thiazol-4-ylmethoxy)-1H-indol-2-yl]methylcarbamic acid.
Molecular Properties
| Compound Name | [5-chloro-3-ethyl-6-(1,3-thiazol-4-ylmethoxy)-1H-indol-2-yl]methylcarbamic acid |
| PubChem CID | 174242689 |
| Molecular Formula | C16H16ClN3O3S |
| Molecular Weight | 365.84 g/mol |
| Exact Mass | 365.06 |
| IUPAC Name | [5-chloro-3-ethyl-6-(1,3-thiazol-4-ylmethoxy)-1H-indol-2-yl]methylcarbamic acid |
| SMILES | CCc1c(CNC(=O)O)[nH]c2cc(OCc3cscn3)c(Cl)cc12 |
| InChI | InChI=1S/C16H16ClN3O3S/c1-2-10-11-3-12(17)15(23-6-9-7-24-8-19-9)4-13(11)20-14(10)5-18-16(21)22/h3-4,7-8,18,20H,2,5-6H2,1H3,(H,21,22) |
| InChIKey | RMFFRTWWBVTHIO-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 87.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.84 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|
Analyze [5-chloro-3-ethyl-6-(1,3-thiazol-4-ylmethoxy)-1H-indol-2-yl]methylcarbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-chloro-3-ethyl-6-(1,3-thiazol-4-ylmethoxy)-1H-indol-2-yl]methylcarbamic acid?
The IUPAC name of [5-chloro-3-ethyl-6-(1,3-thiazol-4-ylmethoxy)-1H-indol-2-yl]methylcarbamic acid (CID 174242689) is [5-chloro-3-ethyl-6-(1,3-thiazol-4-ylmethoxy)-1H-indol-2-yl]methylcarbamic acid.
What is the SMILES notation for [5-chloro-3-ethyl-6-(1,3-thiazol-4-ylmethoxy)-1H-indol-2-yl]methylcarbamic acid?
The canonical SMILES for [5-chloro-3-ethyl-6-(1,3-thiazol-4-ylmethoxy)-1H-indol-2-yl]methylcarbamic acid is CCc1c(CNC(=O)O)[nH]c2cc(OCc3cscn3)c(Cl)cc12.
What is the InChIKey of [5-chloro-3-ethyl-6-(1,3-thiazol-4-ylmethoxy)-1H-indol-2-yl]methylcarbamic acid?
The InChIKey is RMFFRTWWBVTHIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16ClN3O3S/c1-2-10-11-3-12(17)15(23-6-9-7-24-8-19-9)4-13(11)20-14(10)5-18-16(21)22/h3-4,7-8,18,20H,2,5-6H2,1H3,(H,21,22).
What are the key properties of [5-chloro-3-ethyl-6-(1,3-thiazol-4-ylmethoxy)-1H-indol-2-yl]methylcarbamic acid?
[5-chloro-3-ethyl-6-(1,3-thiazol-4-ylmethoxy)-1H-indol-2-yl]methylcarbamic acid has a molecular weight of 365.84 g/mol, XLogP of 4.19, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [5-chloro-3-ethyl-6-(1,3-thiazol-4-ylmethoxy)-1H-indol-2-yl]methylcarbamic acid is sourced from PubChem (CID 174242689), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).