C16H16ClN3O3S — CID 174242689
[5-chloro-3-ethyl-6-(1,3-thiazol-4-ylmethoxy)-1H-indol-2-yl]methylcarbamic acid (PubChem CID 174242689) has the molecular formula C16H16ClN3O3S and a molecular weight of 365.84 g/mol. Its IUPAC name is [5-chloro-3-ethyl-6-(1,3-thiazol-4-ylmethoxy)-1H-indol-2-yl]methylcarbamic acid.
| Compound Name | [5-chloro-3-ethyl-6-(1,3-thiazol-4-ylmethoxy)-1H-indol-2-yl]methylcarbamic acid |
|---|---|
| PubChem CID | 174242689 |
| Molecular Formula | C16H16ClN3O3S |
| Molecular Weight | 365.84 g/mol |
| Exact Mass | 365.06 |
| IUPAC Name | [5-chloro-3-ethyl-6-(1,3-thiazol-4-ylmethoxy)-1H-indol-2-yl]methylcarbamic acid |
| SMILES | CCc1c(CNC(=O)O)[nH]c2cc(OCc3cscn3)c(Cl)cc12 |
| InChI | InChI=1S/C16H16ClN3O3S/c1-2-10-11-3-12(17)15(23-6-9-7-24-8-19-9)4-13(11)20-14(10)5-18-16(21)22/h3-4,7-8,18,20H,2,5-6H2,1H3,(H,21,22) |
| InChIKey | RMFFRTWWBVTHIO-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 87.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.84 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|