C28H19N3 — CID 171732086
2-(3-quinolin-2-ylphenyl)-9-(trideuteriomethyl)-1,10-phenanthroline (PubChem CID 171732086) has the molecular formula C28H19N3 and a molecular weight of 400.50 g/mol. Its IUPAC name is 2-(3-quinolin-2-ylphenyl)-9-(trideuteriomethyl)-1,10-phenanthroline.
| Compound Name | 2-(3-quinolin-2-ylphenyl)-9-(trideuteriomethyl)-1,10-phenanthroline |
|---|---|
| PubChem CID | 171732086 |
| Molecular Formula | C28H19N3 |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | 2-(3-quinolin-2-ylphenyl)-9-(trideuteriomethyl)-1,10-phenanthroline |
| SMILES | [2H]C([2H])([2H])c1ccc2ccc3ccc(-c4cccc(-c5ccc6ccccc6n5)c4)nc3c2n1 |
| InChI | InChI=1S/C28H19N3/c1-18-9-10-20-11-12-21-14-16-26(31-28(21)27(20)29-18)23-7-4-6-22(17-23)25-15-13-19-5-2-3-8-24(19)30-25/h2-17H,1H3/i1D3 |
| InChIKey | UGUJFXMXKVWGTF-FIBGUPNXSA-N |
| XLogP | 6.97 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|