C39H26N4 — CID 171732240
2-[3-[3-(3-phenylphenyl)quinoxalin-2-yl]phenyl]-9-(trideuteriomethyl)-1,10-phenanthroline (PubChem CID 171732240) has the molecular formula C39H26N4 and a molecular weight of 553.68 g/mol. Its IUPAC name is 2-[3-[3-(3-phenylphenyl)quinoxalin-2-yl]phenyl]-9-(trideuteriomethyl)-1,10-phenanthroline.
| Compound Name | 2-[3-[3-(3-phenylphenyl)quinoxalin-2-yl]phenyl]-9-(trideuteriomethyl)-1,10-phenanthroline |
|---|---|
| PubChem CID | 171732240 |
| Molecular Formula | C39H26N4 |
| Molecular Weight | 553.68 g/mol |
| Exact Mass | 553.23 |
| IUPAC Name | 2-[3-[3-(3-phenylphenyl)quinoxalin-2-yl]phenyl]-9-(trideuteriomethyl)-1,10-phenanthroline |
| SMILES | [2H]C([2H])([2H])c1ccc2ccc3ccc(-c4cccc(-c5nc6ccccc6nc5-c5cccc(-c6ccccc6)c5)c4)nc3c2n1 |
| InChI | InChI=1S/C39H26N4/c1-25-17-18-27-19-20-28-21-22-33(41-37(28)36(27)40-25)30-12-8-14-32(24-30)39-38(42-34-15-5-6-16-35(34)43-39)31-13-7-11-29(23-31)26-9-3-2-4-10-26/h2-24H,1H3/i1D3 |
| InChIKey | KZMXAUDWTPLSIH-FIBGUPNXSA-N |
| XLogP | 9.70 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.68 |
| LogP ≤ 5 | 9.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|