C18H9NO — CID 171732680
13-oxa-1-azahexacyclo[10.7.1.02,7.03,18.08,20.014,19]icosa-2,4,6,8(20),9,11,14,16,18-nonaene (PubChem CID 171732680) has the molecular formula C18H9NO and a molecular weight of 255.28 g/mol. Its IUPAC name is 13-oxa-1-azahexacyclo[10.7.1.02,7.03,18.08,20.014,19]icosa-2,4,6,8(20),9,11,14,16,18-nonaene.
| Compound Name | 13-oxa-1-azahexacyclo[10.7.1.02,7.03,18.08,20.014,19]icosa-2,4,6,8(20),9,11,14,16,18-nonaene |
|---|---|
| PubChem CID | 171732680 |
| Molecular Formula | C18H9NO |
| Molecular Weight | 255.28 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | 13-oxa-1-azahexacyclo[10.7.1.02,7.03,18.08,20.014,19]icosa-2,4,6,8(20),9,11,14,16,18-nonaene |
| SMILES | c1cc2c3c(c1)c1cccc4c5cccc(c5n3c14)O2 |
| InChI | InChI=1S/C18H9NO/c1-4-10-12-6-2-8-14-17(12)19-16(10)11(5-1)13-7-3-9-15(20-14)18(13)19/h1-9H |
| InChIKey | NDXXEDGYWBOQKG-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 13.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.28 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |