C20H24N2O6 — CID 171733426
1-O-tert-butyl 2-O,4-O-dimethyl 4-(2-cyanophenyl)pyrrolidine-1,2,4-tricarboxylate (PubChem CID 171733426) has the molecular formula C20H24N2O6 and a molecular weight of 388.42 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O,4-O-dimethyl 4-(2-cyanophenyl)pyrrolidine-1,2,4-tricarboxylate.
| Compound Name | 1-O-tert-butyl 2-O,4-O-dimethyl 4-(2-cyanophenyl)pyrrolidine-1,2,4-tricarboxylate |
|---|---|
| PubChem CID | 171733426 |
| Molecular Formula | C20H24N2O6 |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | 1-O-tert-butyl 2-O,4-O-dimethyl 4-(2-cyanophenyl)pyrrolidine-1,2,4-tricarboxylate |
| SMILES | COC(=O)C1CC(C(=O)OC)(c2ccccc2C#N)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H24N2O6/c1-19(2,3)28-18(25)22-12-20(17(24)27-5,10-15(22)16(23)26-4)14-9-7-6-8-13(14)11-21/h6-9,15H,10,12H2,1-5H3 |
| InChIKey | KLRKRSILPVTHNF-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 105.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|