C25H29FN10O — CID 171733777
2-N-[(3R,4S)-3-fluoro-1-(3-isocyanooxetan-3-yl)piperidin-4-yl]-5-(2-methyl-3-propan-2-ylimidazo[4,5-b]pyridin-5-yl)pyrrolo[2,1-f][1,2,4]triazine-2,4-diamine (PubChem CID 171733777) has the molecular formula C25H29FN10O and a molecular weight of 504.57 g/mol. Its IUPAC name is 2-N-[(3R,4S)-3-fluoro-1-(3-isocyanooxetan-3-yl)piperidin-4-yl]-5-(2-methyl-3-propan-2-ylimidazo[4,5-b]pyridin-5-yl)pyrrolo[2,1-f][1,2,4]triazine-2,4-diamine.
| Compound Name | 2-N-[(3R,4S)-3-fluoro-1-(3-isocyanooxetan-3-yl)piperidin-4-yl]-5-(2-methyl-3-propan-2-ylimidazo[4,5-b]pyridin-5-yl)pyrrolo[2,1-f][1,2,4]triazine-2,4-diamine |
|---|---|
| PubChem CID | 171733777 |
| Molecular Formula | C25H29FN10O |
| Molecular Weight | 504.57 g/mol |
| Exact Mass | 504.25 |
| IUPAC Name | 2-N-[(3R,4S)-3-fluoro-1-(3-isocyanooxetan-3-yl)piperidin-4-yl]-5-(2-methyl-3-propan-2-ylimidazo[4,5-b]pyridin-5-yl)pyrrolo[2,1-f][1,2,4]triazine-2,4-diamine |
| SMILES | [C-]#[N+]C1(N2CC[C@H](Nc3nc(N)c4c(-c5ccc6nc(C)n(C(C)C)c6n5)ccn4n3)[C@H](F)C2)COC1 |
| InChI | InChI=1S/C25H29FN10O/c1-14(2)36-15(3)29-20-6-5-18(30-23(20)36)16-7-10-35-21(16)22(27)32-24(33-35)31-19-8-9-34(11-17(19)26)25(28-4)12-37-13-25/h5-7,10,14,17,19H,8-9,11-13H2,1-3H3,(H3,27,31,32,33)/t17-,19+/m1/s1 |
| InChIKey | XTFOAZBUFZHJGS-MJGOQNOKSA-N |
| XLogP | 3.08 |
| TPSA | 115.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.57 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|