C23H29F2N9 — CID 171733976
2-N-[(4R)-1-ethyl-3,3-difluoropiperidin-4-yl]-5-(2-methyl-3-propan-2-ylimidazo[4,5-b]pyridin-5-yl)pyrrolo[2,1-f][1,2,4]triazine-2,4-diamine (PubChem CID 171733976) has the molecular formula C23H29F2N9 and a molecular weight of 469.54 g/mol. Its IUPAC name is 2-N-[(4R)-1-ethyl-3,3-difluoropiperidin-4-yl]-5-(2-methyl-3-propan-2-ylimidazo[4,5-b]pyridin-5-yl)pyrrolo[2,1-f][1,2,4]triazine-2,4-diamine.
| Compound Name | 2-N-[(4R)-1-ethyl-3,3-difluoropiperidin-4-yl]-5-(2-methyl-3-propan-2-ylimidazo[4,5-b]pyridin-5-yl)pyrrolo[2,1-f][1,2,4]triazine-2,4-diamine |
|---|---|
| PubChem CID | 171733976 |
| Molecular Formula | C23H29F2N9 |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.25 |
| IUPAC Name | 2-N-[(4R)-1-ethyl-3,3-difluoropiperidin-4-yl]-5-(2-methyl-3-propan-2-ylimidazo[4,5-b]pyridin-5-yl)pyrrolo[2,1-f][1,2,4]triazine-2,4-diamine |
| SMILES | CCN1CC[C@@H](Nc2nc(N)c3c(-c4ccc5nc(C)n(C(C)C)c5n4)ccn3n2)C(F)(F)C1 |
| InChI | InChI=1S/C23H29F2N9/c1-5-32-10-9-18(23(24,25)12-32)29-22-30-20(26)19-15(8-11-33(19)31-22)16-6-7-17-21(28-16)34(13(2)3)14(4)27-17/h6-8,11,13,18H,5,9-10,12H2,1-4H3,(H3,26,29,30,31)/t18-/m1/s1 |
| InChIKey | MOQYRFMMKJYBPX-GOSISDBHSA-N |
| XLogP | 3.75 |
| TPSA | 102.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |