C68H70N3OPt- — CID 171734212
2-[5-[2,6-bis[3,5-di(propan-2-yl)phenyl]phenyl]-1-(2,6-dimethylphenyl)-4-phenylbenzimidazol-2-yl]-5,5,6,6-tetramethylbenzo[h]quinolin-10-ol;platinum (PubChem CID 171734212) has the molecular formula C68H70N3OPt- and a molecular weight of 1140.41 g/mol. Its IUPAC name is 2-[5-[2,6-bis[3,5-di(propan-2-yl)phenyl]phenyl]-1-(2,6-dimethylphenyl)-4-phenylbenzimidazol-2-yl]-5,5,6,6-tetramethylbenzo[h]quinolin-10-ol;platinum.
| Compound Name | 2-[5-[2,6-bis[3,5-di(propan-2-yl)phenyl]phenyl]-1-(2,6-dimethylphenyl)-4-phenylbenzimidazol-2-yl]-5,5,6,6-tetramethylbenzo[h]quinolin-10-ol;platinum |
|---|---|
| PubChem CID | 171734212 |
| Molecular Formula | C68H70N3OPt- |
| Molecular Weight | 1140.41 g/mol |
| Exact Mass | 1139.52 |
| IUPAC Name | 2-[5-[2,6-bis[3,5-di(propan-2-yl)phenyl]phenyl]-1-(2,6-dimethylphenyl)-4-phenylbenzimidazol-2-yl]-5,5,6,6-tetramethylbenzo[h]quinolin-10-ol;platinum |
| SMILES | Cc1cccc(C)c1-n1c(-c2ccc3c(n2)-c2c(O)cccc2C(C)(C)C3(C)C)nc2c(-c3[c-]cccc3)c(-c3c(-c4cc(C(C)C)cc(C(C)C)c4)cccc3-c3cc(C(C)C)cc(C(C)C)c3)ccc21.[Pt] |
| InChI | InChI=1S/C68H70N3O.Pt/c1-39(2)46-33-47(40(3)4)36-50(35-46)52-25-19-26-53(51-37-48(41(5)6)34-49(38-51)42(7)8)61(52)54-29-32-58-64(60(54)45-23-16-15-17-24-45)70-66(71(58)65-43(9)21-18-22-44(65)10)57-31-30-56-63(69-57)62-55(27-20-28-59(62)72)67(11,12)68(56,13)14;/h15-23,25-42,72H,1-14H3;/q-1; |
| InChIKey | CCQWLMZCNJEIFC-UHFFFAOYSA-N |
| XLogP | 18.61 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 73 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1140.41 |
| LogP ≤ 5 | 18.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|