C38H28F3NO — CID 171734674
14,14,22,22-tetramethyl-6-(3-phenoxyphenyl)-17-(trifluoromethyl)-7-azahexacyclo[17.2.1.02,11.05,10.013,21.015,20]docosa-1,3,5(10),6,8,11,13(21),15(20),16,18-decaene (PubChem CID 171734674) has the molecular formula C38H28F3NO and a molecular weight of 571.64 g/mol. Its IUPAC name is 14,14,22,22-tetramethyl-6-(3-phenoxyphenyl)-17-(trifluoromethyl)-7-azahexacyclo[17.2.1.02,11.05,10.013,21.015,20]docosa-1,3,5(10),6,8,11,13(21),15(20),16,18-decaene.
| Compound Name | 14,14,22,22-tetramethyl-6-(3-phenoxyphenyl)-17-(trifluoromethyl)-7-azahexacyclo[17.2.1.02,11.05,10.013,21.015,20]docosa-1,3,5(10),6,8,11,13(21),15(20),16,18-decaene |
|---|---|
| PubChem CID | 171734674 |
| Molecular Formula | C38H28F3NO |
| Molecular Weight | 571.64 g/mol |
| Exact Mass | 571.21 |
| IUPAC Name | 14,14,22,22-tetramethyl-6-(3-phenoxyphenyl)-17-(trifluoromethyl)-7-azahexacyclo[17.2.1.02,11.05,10.013,21.015,20]docosa-1,3,5(10),6,8,11,13(21),15(20),16,18-decaene |
| SMILES | CC1(C)c2cc(C(F)(F)F)cc3c2-c2c1cc1c(ccc4c(-c5cccc(Oc6ccccc6)c5)nccc41)c2C3(C)C |
| InChI | InChI=1S/C38H28F3NO/c1-36(2)29-18-22(38(39,40)41)19-30-32(29)33-31(36)20-28-25-15-16-42-35(27(25)14-13-26(28)34(33)37(30,3)4)21-9-8-12-24(17-21)43-23-10-6-5-7-11-23/h5-20H,1-4H3 |
| InChIKey | AUONXUNPDMRLGD-UHFFFAOYSA-N |
| XLogP | 10.81 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.64 |
| LogP ≤ 5 | 10.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|