C65H44N6Si2 — CID 171737240
3-[4-carbazol-9-yl-6-(3-isocyano-5-triphenylsilylphenyl)-1,3,5-triazin-2-yl]-5-triphenylsilylbenzonitrile (PubChem CID 171737240) has the molecular formula C65H44N6Si2 and a molecular weight of 965.28 g/mol. Its IUPAC name is 3-[4-carbazol-9-yl-6-(3-isocyano-5-triphenylsilylphenyl)-1,3,5-triazin-2-yl]-5-triphenylsilylbenzonitrile.
| Compound Name | 3-[4-carbazol-9-yl-6-(3-isocyano-5-triphenylsilylphenyl)-1,3,5-triazin-2-yl]-5-triphenylsilylbenzonitrile |
|---|---|
| PubChem CID | 171737240 |
| Molecular Formula | C65H44N6Si2 |
| Molecular Weight | 965.28 g/mol |
| Exact Mass | 964.32 |
| IUPAC Name | 3-[4-carbazol-9-yl-6-(3-isocyano-5-triphenylsilylphenyl)-1,3,5-triazin-2-yl]-5-triphenylsilylbenzonitrile |
| SMILES | [C-]#[N+]c1cc(-c2nc(-c3cc(C#N)cc([Si](c4ccccc4)(c4ccccc4)c4ccccc4)c3)nc(-n3c4ccccc4c4ccccc43)n2)cc([Si](c2ccccc2)(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C65H44N6Si2/c1-67-50-42-49(44-58(45-50)73(54-30-14-5-15-31-54,55-32-16-6-17-33-55)56-34-18-7-19-35-56)64-68-63(69-65(70-64)71-61-38-22-20-36-59(61)60-37-21-23-39-62(60)71)48-40-47(46-66)41-57(43-48)72(51-24-8-2-9-25-51,52-26-10-3-11-27-52)53-28-12-4-13-29-53/h2-45H |
| InChIKey | NPSOPCHCLKLWTJ-UHFFFAOYSA-N |
| XLogP | 9.48 |
| TPSA | 71.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 73 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 965.28 |
| LogP ≤ 5 | 9.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|