C44H29N3Si — CID 153318872
3-(2-carbazol-9-yl-6-isocyanophenyl)-5-triphenylsilylbenzonitrile (PubChem CID 153318872) has the molecular formula C44H29N3Si and a molecular weight of 627.82 g/mol. Its IUPAC name is 3-(2-carbazol-9-yl-6-isocyanophenyl)-5-triphenylsilylbenzonitrile.
| Compound Name | 3-(2-carbazol-9-yl-6-isocyanophenyl)-5-triphenylsilylbenzonitrile |
|---|---|
| PubChem CID | 153318872 |
| Molecular Formula | C44H29N3Si |
| Molecular Weight | 627.82 g/mol |
| Exact Mass | 627.21 |
| IUPAC Name | 3-(2-carbazol-9-yl-6-isocyanophenyl)-5-triphenylsilylbenzonitrile |
| SMILES | [C-]#[N+]c1cccc(-n2c3ccccc3c3ccccc32)c1-c1cc(C#N)cc([Si](c2ccccc2)(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C44H29N3Si/c1-46-40-24-15-27-43(47-41-25-13-11-22-38(41)39-23-12-14-26-42(39)47)44(40)33-28-32(31-45)29-37(30-33)48(34-16-5-2-6-17-34,35-18-7-3-8-19-35)36-20-9-4-10-21-36/h2-30H |
| InChIKey | RCNZAGOLZWOXAT-UHFFFAOYSA-N |
| XLogP | 8.25 |
| TPSA | 33.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.82 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|