C46H27N3 — CID 167336267
9-[3-isocyano-2-[3-isocyano-5-(10-phenylanthracen-9-yl)phenyl]phenyl]carbazole (PubChem CID 167336267) has the molecular formula C46H27N3 and a molecular weight of 621.74 g/mol. Its IUPAC name is 9-[3-isocyano-2-[3-isocyano-5-(10-phenylanthracen-9-yl)phenyl]phenyl]carbazole.
| Compound Name | 9-[3-isocyano-2-[3-isocyano-5-(10-phenylanthracen-9-yl)phenyl]phenyl]carbazole |
|---|---|
| PubChem CID | 167336267 |
| Molecular Formula | C46H27N3 |
| Molecular Weight | 621.74 g/mol |
| Exact Mass | 621.22 |
| IUPAC Name | 9-[3-isocyano-2-[3-isocyano-5-(10-phenylanthracen-9-yl)phenyl]phenyl]carbazole |
| SMILES | [C-]#[N+]c1cc(-c2c([N+]#[C-])cccc2-n2c3ccccc3c3ccccc32)cc(-c2c3ccccc3c(-c3ccccc3)c3ccccc23)c1 |
| InChI | InChI=1S/C46H27N3/c1-47-33-28-31(45-38-21-8-6-19-36(38)44(30-15-4-3-5-16-30)37-20-7-9-22-39(37)45)27-32(29-33)46-40(48-2)23-14-26-43(46)49-41-24-12-10-17-34(41)35-18-11-13-25-42(35)49/h3-29H |
| InChIKey | PYRUSHBKRXCOJM-UHFFFAOYSA-N |
| XLogP | 13.19 |
| TPSA | 13.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.74 |
| LogP ≤ 5 | 13.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|