C13H15N2+ — CID 171746802
2-(2,4-dimethylphenyl)-1-methylpyrazin-1-ium (PubChem CID 171746802) has the molecular formula C13H15N2+ and a molecular weight of 199.28 g/mol. Its IUPAC name is 2-(2,4-dimethylphenyl)-1-methylpyrazin-1-ium.
| Compound Name | 2-(2,4-dimethylphenyl)-1-methylpyrazin-1-ium |
|---|---|
| PubChem CID | 171746802 |
| Molecular Formula | C13H15N2+ |
| Molecular Weight | 199.28 g/mol |
| Exact Mass | 199.12 |
| IUPAC Name | 2-(2,4-dimethylphenyl)-1-methylpyrazin-1-ium |
| SMILES | Cc1ccc(-c2cncc[n+]2C)c(C)c1 |
| InChI | InChI=1S/C13H15N2/c1-10-4-5-12(11(2)8-10)13-9-14-6-7-15(13)3/h4-9H,1-3H3/q+1 |
| InChIKey | HTKAHXIZXLCADC-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 16.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.28 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|